C20H23N5O3 — CID 145143188
acetylene;1-(3-ethynylphenyl)-4-(methylamino)pyrazole-3-carboxamide;(3S)-3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 145143188) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is acetylene;1-(3-ethynylphenyl)-4-(methylamino)pyrazole-3-carboxamide;(3S)-3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | acetylene;1-(3-ethynylphenyl)-4-(methylamino)pyrazole-3-carboxamide;(3S)-3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 145143188 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | acetylene;1-(3-ethynylphenyl)-4-(methylamino)pyrazole-3-carboxamide;(3S)-3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | C#C.C#Cc1cccc(-n2cc(NC)c(C(N)=O)n2)c1.CN1CC[C@H](O)C1=O |
| InChI | InChI=1S/C13H12N4O.C5H9NO2.C2H2/c1-3-9-5-4-6-10(7-9)17-8-11(15-2)12(16-17)13(14)18;1-6-3-2-4(7)5(6)8;1-2/h1,4-8,15H,2H3,(H2,14,18);4,7H,2-3H2,1H3;1-2H/t;4-;/m.0./s1 |
| InChIKey | OHHUZFHNYXVKTC-INZIHYEWSA-N |
| XLogP | 0.45 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|