C20H22N4O4S — CID 145143403
2-(3-ethynylphenyl)-5-(oxetan-3-ylamino)-1,3-thiazole-4-carboxamide;(3S)-3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 145143403) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is 2-(3-ethynylphenyl)-5-(oxetan-3-ylamino)-1,3-thiazole-4-carboxamide;(3S)-3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | 2-(3-ethynylphenyl)-5-(oxetan-3-ylamino)-1,3-thiazole-4-carboxamide;(3S)-3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 145143403 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-(3-ethynylphenyl)-5-(oxetan-3-ylamino)-1,3-thiazole-4-carboxamide;(3S)-3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | C#Cc1cccc(-c2nc(C(N)=O)c(NC3COC3)s2)c1.CN1CC[C@H](O)C1=O |
| InChI | InChI=1S/C15H13N3O2S.C5H9NO2/c1-2-9-4-3-5-10(6-9)14-18-12(13(16)19)15(21-14)17-11-7-20-8-11;1-6-3-2-4(7)5(6)8/h1,3-6,11,17H,7-8H2,(H2,16,19);4,7H,2-3H2,1H3/t;4-/m.0/s1 |
| InChIKey | AUXGRQBHROORIK-VWMHFEHESA-N |
| XLogP | 0.91 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|