C21H20N4O3 — CID 144793213
3-(3-ethynylphenyl)indazole-1-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 144793213) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-(3-ethynylphenyl)indazole-1-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | 3-(3-ethynylphenyl)indazole-1-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 144793213 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 3-(3-ethynylphenyl)indazole-1-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | C#Cc1cccc(-c2nn(C(N)=O)c3ccccc23)c1.CN1CCC(O)C1=O |
| InChI | InChI=1S/C16H11N3O.C5H9NO2/c1-2-11-6-5-7-12(10-11)15-13-8-3-4-9-14(13)19(18-15)16(17)20;1-6-3-2-4(7)5(6)8/h1,3-10H,(H2,17,20);4,7H,2-3H2,1H3 |
| InChIKey | TVJHMIGTIZXUIM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|