C23H29N3O2 — CID 144793995
4-[(E)-but-2-en-2-yl]-2-(3-ethynylphenyl)pyrimidine;ethane;3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 144793995) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-[(E)-but-2-en-2-yl]-2-(3-ethynylphenyl)pyrimidine;ethane;3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | 4-[(E)-but-2-en-2-yl]-2-(3-ethynylphenyl)pyrimidine;ethane;3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 144793995 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 4-[(E)-but-2-en-2-yl]-2-(3-ethynylphenyl)pyrimidine;ethane;3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | C#Cc1cccc(-c2nccc(/C(C)=C/C)n2)c1.CC.CN1CCC(O)C1=O |
| InChI | InChI=1S/C16H14N2.C5H9NO2.C2H6/c1-4-12(3)15-9-10-17-16(18-15)14-8-6-7-13(5-2)11-14;1-6-3-2-4(7)5(6)8;1-2/h2,4,6-11H,1,3H3;4,7H,2-3H2,1H3;1-2H3/b12-4+;; |
| InChIKey | VBDZSANXXYBHCO-NOZHJXJUSA-N |
| XLogP | 3.78 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|