C19H19F2N3O — CID 144793496
(6R)-5-(1,1-difluoroethyl)-1-(3-ethynylphenyl)-6-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 144793496) has the molecular formula C19H19F2N3O and a molecular weight of 343.38 g/mol. Its IUPAC name is (6R)-5-(1,1-difluoroethyl)-1-(3-ethynylphenyl)-6-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | (6R)-5-(1,1-difluoroethyl)-1-(3-ethynylphenyl)-6-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 144793496 |
| Molecular Formula | C19H19F2N3O |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (6R)-5-(1,1-difluoroethyl)-1-(3-ethynylphenyl)-6-methyl-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | C#Cc1cccc(-n2nc(C(N)=O)c3c2C[C@@H](C)C(C(C)(F)F)C3)c1 |
| InChI | InChI=1S/C19H19F2N3O/c1-4-12-6-5-7-13(9-12)24-16-8-11(2)15(19(3,20)21)10-14(16)17(23-24)18(22)25/h1,5-7,9,11,15H,8,10H2,2-3H3,(H2,22,25)/t11-,15?/m1/s1 |
| InChIKey | DKKCQCYKTZXQLR-ZRKZCGFPSA-N |
| XLogP | 2.96 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|