C8H11NS — CID 123286494
5-ethynylsulfanyl-4-methyl-1,2,3,6-tetrahydropyridine (PubChem CID 123286494) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is 5-ethynylsulfanyl-4-methyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 5-ethynylsulfanyl-4-methyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 123286494 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 5-ethynylsulfanyl-4-methyl-1,2,3,6-tetrahydropyridine |
| SMILES | C#CSC1=C(C)CCNC1 |
| InChI | InChI=1S/C8H11NS/c1-3-10-8-6-9-5-4-7(8)2/h1,9H,4-6H2,2H3 |
| InChIKey | QGJVRNSGORQCHT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|