About 4-ethylsulfanyl-5-methyl-1,2,3,6-tetrahydropyridine
4-ethylsulfanyl-5-methyl-1,2,3,6-tetrahydropyridine (PubChem CID 143138217) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is 4-ethylsulfanyl-5-methyl-1,2,3,6-tetrahydropyridine.
Analyze 4-ethylsulfanyl-5-methyl-1,2,3,6-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfanyl-5-methyl-1,2,3,6-tetrahydropyridine?
The IUPAC name of 4-ethylsulfanyl-5-methyl-1,2,3,6-tetrahydropyridine (CID 143138217) is 4-ethylsulfanyl-5-methyl-1,2,3,6-tetrahydropyridine.
What is the SMILES notation for 4-ethylsulfanyl-5-methyl-1,2,3,6-tetrahydropyridine?
The canonical SMILES for 4-ethylsulfanyl-5-methyl-1,2,3,6-tetrahydropyridine is CCSC1=C(C)CNCC1.
What is the InChIKey of 4-ethylsulfanyl-5-methyl-1,2,3,6-tetrahydropyridine?
The InChIKey is OYUMFVFKYMUBSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS/c1-3-10-8-4-5-9-6-7(8)2/h9H,3-6H2,1-2H3.
What are the key properties of 4-ethylsulfanyl-5-methyl-1,2,3,6-tetrahydropyridine?
4-ethylsulfanyl-5-methyl-1,2,3,6-tetrahydropyridine has a molecular weight of 157.28 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfanyl-5-methyl-1,2,3,6-tetrahydropyridine is sourced from PubChem (CID 143138217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).