C11H16 — CID 123286787
2,5-dimethylnona-2,4-dien-6-yne (PubChem CID 123286787) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 2,5-dimethylnona-2,4-dien-6-yne.
| Compound Name | 2,5-dimethylnona-2,4-dien-6-yne |
|---|---|
| PubChem CID | 123286787 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 2,5-dimethylnona-2,4-dien-6-yne |
| SMILES | CCC#CC(C)=CC=C(C)C |
| InChI | InChI=1S/C11H16/c1-5-6-7-11(4)9-8-10(2)3/h8-9H,5H2,1-4H3 |
| InChIKey | SLDBVCJDJWAEJM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|