C9H7NO — CID 46878538
nona-2,4,6-triynamide (PubChem CID 46878538) has the molecular formula C9H7NO and a molecular weight of 145.16 g/mol. Its IUPAC name is nona-2,4,6-triynamide.
| Compound Name | nona-2,4,6-triynamide |
|---|---|
| PubChem CID | 46878538 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | nona-2,4,6-triynamide |
| SMILES | CCC#CC#CC#CC(N)=O |
| InChI | InChI=1S/C9H7NO/c1-2-3-4-5-6-7-8-9(10)11/h2H2,1H3,(H2,10,11) |
| InChIKey | ICLHBUBHBUZPFH-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|