C9H10N2O2 — CID 44721770
nona-2,7-diynediamide (PubChem CID 44721770) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is nona-2,7-diynediamide.
| Compound Name | nona-2,7-diynediamide |
|---|---|
| PubChem CID | 44721770 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | nona-2,7-diynediamide |
| SMILES | NC(=O)C#CCCCC#CC(N)=O |
| InChI | InChI=1S/C9H10N2O2/c10-8(12)6-4-2-1-3-5-7-9(11)13/h1-3H2,(H2,10,12)(H2,11,13) |
| InChIKey | KXMRUMNQUBIRMM-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|