C15H27NO4 — CID 123290025
4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid (PubChem CID 123290025) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid.
| Compound Name | 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid |
|---|---|
| PubChem CID | 123290025 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid |
| SMILES | CCC(C)(CC(C)(C)C(=O)O)N(C(C)=O)C(=O)C(C)C |
| InChI | InChI=1S/C15H27NO4/c1-8-15(7,9-14(5,6)13(19)20)16(11(4)17)12(18)10(2)3/h10H,8-9H2,1-7H3,(H,19,20) |
| InChIKey | YWFPZCJPLWJVNW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |