About 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid
4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid (PubChem CID 123290025) has the molecular formula C15H27NO4
and a molecular weight of 285.38 g/mol. Its IUPAC name is 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid.
Molecular Properties
| Compound Name | 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid |
| PubChem CID | 123290025 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid |
| SMILES | CCC(C)(CC(C)(C)C(=O)O)N(C(C)=O)C(=O)C(C)C |
| InChI | InChI=1S/C15H27NO4/c1-8-15(7,9-14(5,6)13(19)20)16(11(4)17)12(18)10(2)3/h10H,8-9H2,1-7H3,(H,19,20) |
| InChIKey | YWFPZCJPLWJVNW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid?
The IUPAC name of 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid (CID 123290025) is 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid.
What is the SMILES notation for 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid?
The canonical SMILES for 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid is CCC(C)(CC(C)(C)C(=O)O)N(C(C)=O)C(=O)C(C)C.
What is the InChIKey of 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid?
The InChIKey is YWFPZCJPLWJVNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO4/c1-8-15(7,9-14(5,6)13(19)20)16(11(4)17)12(18)10(2)3/h10H,8-9H2,1-7H3,(H,19,20).
What are the key properties of 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid?
4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid has a molecular weight of 285.38 g/mol, XLogP of 2.69, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[acetyl(2-methylpropanoyl)amino]-2,2,4-trimethylhexanoic acid is sourced from PubChem (CID 123290025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).