C22H35FN4O3 — CID 123292467
2-[[2-[2-[2-(3-aminopropyl)-5-fluorophenoxy]ethylamino]-2-cyclopropylacetyl]-methylamino]-N-ethylpropanamide (PubChem CID 123292467) has the molecular formula C22H35FN4O3 and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-[[2-[2-[2-(3-aminopropyl)-5-fluorophenoxy]ethylamino]-2-cyclopropylacetyl]-methylamino]-N-ethylpropanamide.
| Compound Name | 2-[[2-[2-[2-(3-aminopropyl)-5-fluorophenoxy]ethylamino]-2-cyclopropylacetyl]-methylamino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 123292467 |
| Molecular Formula | C22H35FN4O3 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 2-[[2-[2-[2-(3-aminopropyl)-5-fluorophenoxy]ethylamino]-2-cyclopropylacetyl]-methylamino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)N(C)C(=O)C(NCCOc1cc(F)ccc1CCCN)C1CC1 |
| InChI | InChI=1S/C22H35FN4O3/c1-4-25-21(28)15(2)27(3)22(29)20(17-7-8-17)26-12-13-30-19-14-18(23)10-9-16(19)6-5-11-24/h9-10,14-15,17,20,26H,4-8,11-13,24H2,1-3H3,(H,25,28) |
| InChIKey | TYOAVWIPHKSMJF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|