C24H39FN4O4 — CID 143168489
2-[2-[5-fluoro-2-[3-(methylamino)propyl]phenoxy]ethylamino]-N,3-dimethyl-N-[2-oxo-2-(2-oxoethylamino)ethyl]hexanamide (PubChem CID 143168489) has the molecular formula C24H39FN4O4 and a molecular weight of 466.60 g/mol. Its IUPAC name is 2-[2-[5-fluoro-2-[3-(methylamino)propyl]phenoxy]ethylamino]-N,3-dimethyl-N-[2-oxo-2-(2-oxoethylamino)ethyl]hexanamide.
| Compound Name | 2-[2-[5-fluoro-2-[3-(methylamino)propyl]phenoxy]ethylamino]-N,3-dimethyl-N-[2-oxo-2-(2-oxoethylamino)ethyl]hexanamide |
|---|---|
| PubChem CID | 143168489 |
| Molecular Formula | C24H39FN4O4 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.30 |
| IUPAC Name | 2-[2-[5-fluoro-2-[3-(methylamino)propyl]phenoxy]ethylamino]-N,3-dimethyl-N-[2-oxo-2-(2-oxoethylamino)ethyl]hexanamide |
| SMILES | CCCC(C)C(NCCOc1cc(F)ccc1CCCNC)C(=O)N(C)CC(=O)NCC=O |
| InChI | InChI=1S/C24H39FN4O4/c1-5-7-18(2)23(24(32)29(4)17-22(31)27-12-14-30)28-13-15-33-21-16-20(25)10-9-19(21)8-6-11-26-3/h9-10,14,16,18,23,26,28H,5-8,11-13,15,17H2,1-4H3,(H,27,31) |
| InChIKey | WZYXGVPERQVDID-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|