C24H39ClN4O4 — CID 143168843
2-[2-[5-chloro-2-(3-formamidopropyl)phenoxy]ethylamino]-3-ethyl-N-[2-(ethylamino)-2-oxoethyl]-N-methylpentanamide (PubChem CID 143168843) has the molecular formula C24H39ClN4O4 and a molecular weight of 483.05 g/mol. Its IUPAC name is 2-[2-[5-chloro-2-(3-formamidopropyl)phenoxy]ethylamino]-3-ethyl-N-[2-(ethylamino)-2-oxoethyl]-N-methylpentanamide.
| Compound Name | 2-[2-[5-chloro-2-(3-formamidopropyl)phenoxy]ethylamino]-3-ethyl-N-[2-(ethylamino)-2-oxoethyl]-N-methylpentanamide |
|---|---|
| PubChem CID | 143168843 |
| Molecular Formula | C24H39ClN4O4 |
| Molecular Weight | 483.05 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 2-[2-[5-chloro-2-(3-formamidopropyl)phenoxy]ethylamino]-3-ethyl-N-[2-(ethylamino)-2-oxoethyl]-N-methylpentanamide |
| SMILES | CCNC(=O)CN(C)C(=O)C(NCCOc1cc(Cl)ccc1CCCNC=O)C(CC)CC |
| InChI | InChI=1S/C24H39ClN4O4/c1-5-18(6-2)23(24(32)29(4)16-22(31)27-7-3)28-13-14-33-21-15-20(25)11-10-19(21)9-8-12-26-17-30/h10-11,15,17-18,23,28H,5-9,12-14,16H2,1-4H3,(H,26,30)(H,27,31) |
| InChIKey | UPOJWFCYIARPLS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.05 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|