C23H41ClN2O3P2 — CID 70987612
(tetramethyl-λ5-phosphanyl) (2S)-2-[2-[5-chloro-2-[3-(dimethylphosphanylmethylamino)propyl]phenoxy]ethylamino]-2-cyclopropylacetate (PubChem CID 70987612) has the molecular formula C23H41ClN2O3P2 and a molecular weight of 490.99 g/mol. Its IUPAC name is (tetramethyl-λ5-phosphanyl) (2S)-2-[2-[5-chloro-2-[3-(dimethylphosphanylmethylamino)propyl]phenoxy]ethylamino]-2-cyclopropylacetate.
| Compound Name | (tetramethyl-λ5-phosphanyl) (2S)-2-[2-[5-chloro-2-[3-(dimethylphosphanylmethylamino)propyl]phenoxy]ethylamino]-2-cyclopropylacetate |
|---|---|
| PubChem CID | 70987612 |
| Molecular Formula | C23H41ClN2O3P2 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | (tetramethyl-λ5-phosphanyl) (2S)-2-[2-[5-chloro-2-[3-(dimethylphosphanylmethylamino)propyl]phenoxy]ethylamino]-2-cyclopropylacetate |
| SMILES | CP(C)CNCCCc1ccc(Cl)cc1OCCN[C@H](C(=O)OP(C)(C)(C)C)C1CC1 |
| InChI | InChI=1S/C23H41ClN2O3P2/c1-30(2)17-25-13-7-8-18-11-12-20(24)16-21(18)28-15-14-26-22(19-9-10-19)23(27)29-31(3,4,5)6/h11-12,16,19,22,25-26H,7-10,13-15,17H2,1-6H3/t22-/m0/s1 |
| InChIKey | KQCQBBMKTZPLGT-QFIPXVFZSA-N |
| XLogP | 4.84 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|