C16H23FN2O4 — CID 94777102
(2S)-2-(4-fluorophenoxy)-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylpropanamide (PubChem CID 94777102) has the molecular formula C16H23FN2O4 and a molecular weight of 326.37 g/mol. Its IUPAC name is (2S)-2-(4-fluorophenoxy)-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylpropanamide.
| Compound Name | (2S)-2-(4-fluorophenoxy)-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 94777102 |
| Molecular Formula | C16H23FN2O4 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (2S)-2-(4-fluorophenoxy)-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylpropanamide |
| SMILES | COCCCNC(=O)CN(C)C(=O)[C@H](C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C16H23FN2O4/c1-12(23-14-7-5-13(17)6-8-14)16(21)19(2)11-15(20)18-9-4-10-22-3/h5-8,12H,4,9-11H2,1-3H3,(H,18,20)/t12-/m0/s1 |
| InChIKey | DUARKRNISNRXIO-LBPRGKRZSA-N |
| XLogP | 1.20 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|