C15H19N5OS — CID 123292573
5-amino-N-[(Z)-5-iminopent-2-enyl]-N,3,4-trimethylthieno[2,3-c]pyridazine-6-carboxamide (PubChem CID 123292573) has the molecular formula C15H19N5OS and a molecular weight of 317.42 g/mol. Its IUPAC name is 5-amino-N-[(Z)-5-iminopent-2-enyl]-N,3,4-trimethylthieno[2,3-c]pyridazine-6-carboxamide.
| Compound Name | 5-amino-N-[(Z)-5-iminopent-2-enyl]-N,3,4-trimethylthieno[2,3-c]pyridazine-6-carboxamide |
|---|---|
| PubChem CID | 123292573 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 5-amino-N-[(Z)-5-iminopent-2-enyl]-N,3,4-trimethylthieno[2,3-c]pyridazine-6-carboxamide |
| SMILES | [H]/N=C/C/C=C\CN(C)C(=O)c1sc2nnc(C)c(C)c2c1N |
| InChI | InChI=1S/C15H19N5OS/c1-9-10(2)18-19-14-11(9)12(17)13(22-14)15(21)20(3)8-6-4-5-7-16/h4,6-7,16H,5,8,17H2,1-3H3/b6-4-,16-7+ |
| InChIKey | JWXQUGVNMUALIM-LRPNAGJPSA-N |
| XLogP | 2.56 |
| TPSA | 95.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|