C20H28N2O4 — CID 123292903
tert-butyl 2-methyl-1-[(3-nitrophenyl)methyl]-3,4,7,8-tetrahydro-2H-azocine-5-carboxylate (PubChem CID 123292903) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is tert-butyl 2-methyl-1-[(3-nitrophenyl)methyl]-3,4,7,8-tetrahydro-2H-azocine-5-carboxylate.
| Compound Name | tert-butyl 2-methyl-1-[(3-nitrophenyl)methyl]-3,4,7,8-tetrahydro-2H-azocine-5-carboxylate |
|---|---|
| PubChem CID | 123292903 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | tert-butyl 2-methyl-1-[(3-nitrophenyl)methyl]-3,4,7,8-tetrahydro-2H-azocine-5-carboxylate |
| SMILES | CC1CCC(C(=O)OC(C)(C)C)=CCCN1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H28N2O4/c1-15-10-11-17(19(23)26-20(2,3)4)8-6-12-21(15)14-16-7-5-9-18(13-16)22(24)25/h5,7-9,13,15H,6,10-12,14H2,1-4H3 |
| InChIKey | GYWGAVYVQQRGJU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|