C17H16N2O4 — CID 139827412
2-methyl-1-[(3-nitrophenyl)methyl]-2,3-dihydroindole-5-carboxylic acid (PubChem CID 139827412) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-methyl-1-[(3-nitrophenyl)methyl]-2,3-dihydroindole-5-carboxylic acid.
| Compound Name | 2-methyl-1-[(3-nitrophenyl)methyl]-2,3-dihydroindole-5-carboxylic acid |
|---|---|
| PubChem CID | 139827412 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-methyl-1-[(3-nitrophenyl)methyl]-2,3-dihydroindole-5-carboxylic acid |
| SMILES | CC1Cc2cc(C(=O)O)ccc2N1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N2O4/c1-11-7-14-9-13(17(20)21)5-6-16(14)18(11)10-12-3-2-4-15(8-12)19(22)23/h2-6,8-9,11H,7,10H2,1H3,(H,20,21) |
| InChIKey | OVDJYEUDMYJDSL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|