C45H62O7 — CID 123293121
[2,10-dihydroxy-4,5,9,9,13,20,20-heptamethyl-23-(3-phenylprop-2-enoyloxy)-25-oxaheptacyclo[15.6.2.01,18.04,17.05,14.08,13.021,24]pentacosan-22-yl] 2-methylbut-2-enoate (PubChem CID 123293121) has the molecular formula C45H62O7 and a molecular weight of 714.98 g/mol. Its IUPAC name is [2,10-dihydroxy-4,5,9,9,13,20,20-heptamethyl-23-(3-phenylprop-2-enoyloxy)-25-oxaheptacyclo[15.6.2.01,18.04,17.05,14.08,13.021,24]pentacosan-22-yl] 2-methylbut-2-enoate.
| Compound Name | [2,10-dihydroxy-4,5,9,9,13,20,20-heptamethyl-23-(3-phenylprop-2-enoyloxy)-25-oxaheptacyclo[15.6.2.01,18.04,17.05,14.08,13.021,24]pentacosan-22-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 123293121 |
| Molecular Formula | C45H62O7 |
| Molecular Weight | 714.98 g/mol |
| Exact Mass | 714.45 |
| IUPAC Name | [2,10-dihydroxy-4,5,9,9,13,20,20-heptamethyl-23-(3-phenylprop-2-enoyloxy)-25-oxaheptacyclo[15.6.2.01,18.04,17.05,14.08,13.021,24]pentacosan-22-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C2C3OC45CCC6C7(C)CCC(O)C(C)(C)C7CCC6(C)C4(C)CC(O)C3(C1OC(=O)C=Cc1ccccc1)C5CC2(C)C |
| InChI | InChI=1S/C45H62O7/c1-10-26(2)38(49)51-35-34-36-45(37(35)50-33(48)17-16-27-14-12-11-13-15-27)30(24-39(34,3)4)44(52-36)23-19-29-41(7)21-20-31(46)40(5,6)28(41)18-22-42(29,8)43(44,9)25-32(45)47/h10-17,28-32,34-37,46-47H,18-25H2,1-9H3 |
| InChIKey | OFPOIDOUHRXSLP-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.98 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|