C21H27F3N4O3 — CID 123296279
methyl 3-[[1-(tert-butylamino)-2-[4-(trifluoromethyl)benzoyl]butyl]amino]-1H-pyrazole-5-carboxylate (PubChem CID 123296279) has the molecular formula C21H27F3N4O3 and a molecular weight of 440.47 g/mol. Its IUPAC name is methyl 3-[[1-(tert-butylamino)-2-[4-(trifluoromethyl)benzoyl]butyl]amino]-1H-pyrazole-5-carboxylate.
| Compound Name | methyl 3-[[1-(tert-butylamino)-2-[4-(trifluoromethyl)benzoyl]butyl]amino]-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 123296279 |
| Molecular Formula | C21H27F3N4O3 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | methyl 3-[[1-(tert-butylamino)-2-[4-(trifluoromethyl)benzoyl]butyl]amino]-1H-pyrazole-5-carboxylate |
| SMILES | CCC(C(=O)c1ccc(C(F)(F)F)cc1)C(Nc1cc(C(=O)OC)[nH]n1)NC(C)(C)C |
| InChI | InChI=1S/C21H27F3N4O3/c1-6-14(17(29)12-7-9-13(10-8-12)21(22,23)24)18(26-20(2,3)4)25-16-11-15(27-28-16)19(30)31-5/h7-11,14,18,26H,6H2,1-5H3,(H2,25,27,28) |
| InChIKey | NZHWNFBEKCAOKL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|