C20H19F3O3 — CID 176574026
methyl 4-(4-methylphenyl)-2-[4-(trifluoromethyl)benzoyl]butanoate (PubChem CID 176574026) has the molecular formula C20H19F3O3 and a molecular weight of 364.36 g/mol. Its IUPAC name is methyl 4-(4-methylphenyl)-2-[4-(trifluoromethyl)benzoyl]butanoate.
| Compound Name | methyl 4-(4-methylphenyl)-2-[4-(trifluoromethyl)benzoyl]butanoate |
|---|---|
| PubChem CID | 176574026 |
| Molecular Formula | C20H19F3O3 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | methyl 4-(4-methylphenyl)-2-[4-(trifluoromethyl)benzoyl]butanoate |
| SMILES | COC(=O)C(CCc1ccc(C)cc1)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F3O3/c1-13-3-5-14(6-4-13)7-12-17(19(25)26-2)18(24)15-8-10-16(11-9-15)20(21,22)23/h3-6,8-11,17H,7,12H2,1-2H3 |
| InChIKey | JSHCFXWMELVLBI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|