C13H17N5O3S — CID 123296797
2-[[[[5-(1,3-dimethylpyrazol-4-yl)furan-2-yl]-hydrazinylmethylidene]amino]methylsulfanyl]acetic acid (PubChem CID 123296797) has the molecular formula C13H17N5O3S and a molecular weight of 323.38 g/mol. Its IUPAC name is 2-[[[[5-(1,3-dimethylpyrazol-4-yl)furan-2-yl]-hydrazinylmethylidene]amino]methylsulfanyl]acetic acid.
| Compound Name | 2-[[[[5-(1,3-dimethylpyrazol-4-yl)furan-2-yl]-hydrazinylmethylidene]amino]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 123296797 |
| Molecular Formula | C13H17N5O3S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-[[[[5-(1,3-dimethylpyrazol-4-yl)furan-2-yl]-hydrazinylmethylidene]amino]methylsulfanyl]acetic acid |
| SMILES | Cc1nn(C)cc1-c1ccc(C(=NCSCC(=O)O)NN)o1 |
| InChI | InChI=1S/C13H17N5O3S/c1-8-9(5-18(2)17-8)10-3-4-11(21-10)13(16-14)15-7-22-6-12(19)20/h3-5H,6-7,14H2,1-2H3,(H,15,16)(H,19,20) |
| InChIKey | JSTIPALZUBNFQZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 118.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|