C14H13F3N4O3S — CID 123608021
2-[[[hydrazinyl-[5-[6-(trifluoromethyl)-3-pyridinyl]furan-2-yl]methylidene]amino]methylsulfanyl]acetic acid (PubChem CID 123608021) has the molecular formula C14H13F3N4O3S and a molecular weight of 374.34 g/mol. Its IUPAC name is 2-[[[hydrazinyl-[5-[6-(trifluoromethyl)-3-pyridinyl]furan-2-yl]methylidene]amino]methylsulfanyl]acetic acid.
| Compound Name | 2-[[[hydrazinyl-[5-[6-(trifluoromethyl)-3-pyridinyl]furan-2-yl]methylidene]amino]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 123608021 |
| Molecular Formula | C14H13F3N4O3S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-[[[hydrazinyl-[5-[6-(trifluoromethyl)-3-pyridinyl]furan-2-yl]methylidene]amino]methylsulfanyl]acetic acid |
| SMILES | NNC(=NCSCC(=O)O)c1ccc(-c2ccc(C(F)(F)F)nc2)o1 |
| InChI | InChI=1S/C14H13F3N4O3S/c15-14(16,17)11-4-1-8(5-19-11)9-2-3-10(24-9)13(21-18)20-7-25-6-12(22)23/h1-5H,6-7,18H2,(H,20,21)(H,22,23) |
| InChIKey | LJIJDYVUNAPYDU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|