C17H19F3N2O4S — CID 170770330
2-amino-4-[4,4,4-trifluoro-3-[5-(furan-2-yl)-2-pyridinyl]-3-hydroxybutyl]sulfanylbutanoic acid (PubChem CID 170770330) has the molecular formula C17H19F3N2O4S and a molecular weight of 404.41 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-[5-(furan-2-yl)-2-pyridinyl]-3-hydroxybutyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-[5-(furan-2-yl)-2-pyridinyl]-3-hydroxybutyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170770330 |
| Molecular Formula | C17H19F3N2O4S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-[5-(furan-2-yl)-2-pyridinyl]-3-hydroxybutyl]sulfanylbutanoic acid |
| SMILES | NC(CCSCCC(O)(c1ccc(-c2ccco2)cn1)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C17H19F3N2O4S/c18-17(19,20)16(25,6-9-27-8-5-12(21)15(23)24)14-4-3-11(10-22-14)13-2-1-7-26-13/h1-4,7,10,12,25H,5-6,8-9,21H2,(H,23,24) |
| InChIKey | NEYPCCMPHHQKJI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|