C58H48Si2 — CID 123296950
4,10c-dihydropyren-1-yl-[4-[10-[4-[dimethyl(phenyl)silyl]phenyl]-3-phenylanthracen-9-yl]phenyl]-dimethylsilane (PubChem CID 123296950) has the molecular formula C58H48Si2 and a molecular weight of 801.19 g/mol. Its IUPAC name is 4,10c-dihydropyren-1-yl-[4-[10-[4-[dimethyl(phenyl)silyl]phenyl]-3-phenylanthracen-9-yl]phenyl]-dimethylsilane.
| Compound Name | 4,10c-dihydropyren-1-yl-[4-[10-[4-[dimethyl(phenyl)silyl]phenyl]-3-phenylanthracen-9-yl]phenyl]-dimethylsilane |
|---|---|
| PubChem CID | 123296950 |
| Molecular Formula | C58H48Si2 |
| Molecular Weight | 801.19 g/mol |
| Exact Mass | 800.33 |
| IUPAC Name | 4,10c-dihydropyren-1-yl-[4-[10-[4-[dimethyl(phenyl)silyl]phenyl]-3-phenylanthracen-9-yl]phenyl]-dimethylsilane |
| SMILES | C[Si](C)(c1ccccc1)c1ccc(-c2c3ccccc3c(-c3ccc([Si](C)(C)c4ccc5c6c4C=CC4=CC=CC(=CC5)C46)cc3)c3ccc(-c4ccccc4)cc23)cc1 |
| InChI | InChI=1S/C58H48Si2/c1-59(2,46-18-9-6-10-19-46)47-31-24-43(25-32-47)57-50-21-12-11-20-49(50)56(51-35-29-45(38-53(51)57)39-14-7-5-8-15-39)42-26-33-48(34-27-42)60(3,4)54-37-30-44-23-22-40-16-13-17-41-28-36-52(54)58(44)55(40)41/h5-22,24-38,55H,23H2,1-4H3 |
| InChIKey | MHGKJVUMECHPQP-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.19 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|