C26H40F3NO3S — CID 123298116
N-[5-(4-cyclohexylbenzoyl)-6,6-dimethylheptyl]-1,1,1-trifluoro-N-propylmethanesulfonamide (PubChem CID 123298116) has the molecular formula C26H40F3NO3S and a molecular weight of 503.67 g/mol. Its IUPAC name is N-[5-(4-cyclohexylbenzoyl)-6,6-dimethylheptyl]-1,1,1-trifluoro-N-propylmethanesulfonamide.
| Compound Name | N-[5-(4-cyclohexylbenzoyl)-6,6-dimethylheptyl]-1,1,1-trifluoro-N-propylmethanesulfonamide |
|---|---|
| PubChem CID | 123298116 |
| Molecular Formula | C26H40F3NO3S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | N-[5-(4-cyclohexylbenzoyl)-6,6-dimethylheptyl]-1,1,1-trifluoro-N-propylmethanesulfonamide |
| SMILES | CCCN(CCCCC(C(=O)c1ccc(C2CCCCC2)cc1)C(C)(C)C)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C26H40F3NO3S/c1-5-18-30(34(32,33)26(27,28)29)19-10-9-13-23(25(2,3)4)24(31)22-16-14-21(15-17-22)20-11-7-6-8-12-20/h14-17,20,23H,5-13,18-19H2,1-4H3 |
| InChIKey | HONUWWULGWMJQO-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|