C20H16F3NO3S — CID 3707866
1,2-diphenyl-2-[1-(trifluoromethylsulfonyl)-4H-pyridin-4-yl]ethanone (PubChem CID 3707866) has the molecular formula C20H16F3NO3S and a molecular weight of 407.41 g/mol. Its IUPAC name is 1,2-diphenyl-2-[1-(trifluoromethylsulfonyl)-4H-pyridin-4-yl]ethanone.
| Compound Name | 1,2-diphenyl-2-[1-(trifluoromethylsulfonyl)-4H-pyridin-4-yl]ethanone |
|---|---|
| PubChem CID | 3707866 |
| Molecular Formula | C20H16F3NO3S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 1,2-diphenyl-2-[1-(trifluoromethylsulfonyl)-4H-pyridin-4-yl]ethanone |
| SMILES | O=C(c1ccccc1)C(c1ccccc1)C1C=CN(S(=O)(=O)C(F)(F)F)C=C1 |
| InChI | InChI=1S/C20H16F3NO3S/c21-20(22,23)28(26,27)24-13-11-16(12-14-24)18(15-7-3-1-4-8-15)19(25)17-9-5-2-6-10-17/h1-14,16,18H |
| InChIKey | YQSWWOPWHKYKLA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |