C10H12N2 — CID 123300527
4,4a,5,8a-tetrahydronaphthalene-1,8-diimine (PubChem CID 123300527) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 4,4a,5,8a-tetrahydronaphthalene-1,8-diimine.
| Compound Name | 4,4a,5,8a-tetrahydronaphthalene-1,8-diimine |
|---|---|
| PubChem CID | 123300527 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4,4a,5,8a-tetrahydronaphthalene-1,8-diimine |
| SMILES | [H]/N=C1\C=CCC2CC=C/C(=N\[H])C12 |
| InChI | InChI=1S/C10H12N2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-2,5-7,10-12H,3-4H2/b11-8+,12-9+ |
| InChIKey | IPHGVEBUUGQHKZ-HZOWPXDZSA-N |
| XLogP | 2.18 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|