C10H15N — CID 90688400
4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-imine (PubChem CID 90688400) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-imine.
| Compound Name | 4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-imine |
|---|---|
| PubChem CID | 90688400 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-imine |
| SMILES | [H]/N=C1\C=CCC2CCCCC12 |
| InChI | InChI=1S/C10H15N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h3,7-9,11H,1-2,4-6H2/b11-10+ |
| InChIKey | AECCONTYUOJCFL-ZHACJKMWSA-N |
| XLogP | 2.77 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|