C18H21F2N3O — CID 123301646
2-[2-(4,6-difluorocyclohexa-1,5-dien-1-yl)oxypropan-2-yl]-1-ethylbenzimidazol-5-amine (PubChem CID 123301646) has the molecular formula C18H21F2N3O and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-[2-(4,6-difluorocyclohexa-1,5-dien-1-yl)oxypropan-2-yl]-1-ethylbenzimidazol-5-amine.
| Compound Name | 2-[2-(4,6-difluorocyclohexa-1,5-dien-1-yl)oxypropan-2-yl]-1-ethylbenzimidazol-5-amine |
|---|---|
| PubChem CID | 123301646 |
| Molecular Formula | C18H21F2N3O |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[2-(4,6-difluorocyclohexa-1,5-dien-1-yl)oxypropan-2-yl]-1-ethylbenzimidazol-5-amine |
| SMILES | CCn1c(C(C)(C)OC2=CCC(F)C=C2F)nc2cc(N)ccc21 |
| InChI | InChI=1S/C18H21F2N3O/c1-4-23-15-7-6-12(21)10-14(15)22-17(23)18(2,3)24-16-8-5-11(19)9-13(16)20/h6-11H,4-5,21H2,1-3H3 |
| InChIKey | LGBKEJIXATVIAH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|