C29H45NO9S — CID 123302540
5-O-tert-butyl 1-O-(2-methylbut-3-en-2-yl) 4-[3-(4-methylphenyl)sulfonyloxypropyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 123302540) has the molecular formula C29H45NO9S and a molecular weight of 583.74 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-(2-methylbut-3-en-2-yl) 4-[3-(4-methylphenyl)sulfonyloxypropyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-(2-methylbut-3-en-2-yl) 4-[3-(4-methylphenyl)sulfonyloxypropyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 123302540 |
| Molecular Formula | C29H45NO9S |
| Molecular Weight | 583.74 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | 5-O-tert-butyl 1-O-(2-methylbut-3-en-2-yl) 4-[3-(4-methylphenyl)sulfonyloxypropyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | C=CC(C)(C)OC(=O)C(CC(CCCOS(=O)(=O)c1ccc(C)cc1)C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H45NO9S/c1-11-29(9,10)38-25(32)23(30-26(33)39-28(6,7)8)19-21(24(31)37-27(3,4)5)13-12-18-36-40(34,35)22-16-14-20(2)15-17-22/h11,14-17,21,23H,1,12-13,18-19H2,2-10H3,(H,30,33) |
| InChIKey | DQDCQNQYNXLPKH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.74 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|