C20H26F3NO9S — CID 154287437
2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[3-(trifluoromethyl)phenyl]sulfonyloxypropyl]pentanedioic acid (PubChem CID 154287437) has the molecular formula C20H26F3NO9S and a molecular weight of 513.49 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[3-(trifluoromethyl)phenyl]sulfonyloxypropyl]pentanedioic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[3-(trifluoromethyl)phenyl]sulfonyloxypropyl]pentanedioic acid |
|---|---|
| PubChem CID | 154287437 |
| Molecular Formula | C20H26F3NO9S |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-[3-[3-(trifluoromethyl)phenyl]sulfonyloxypropyl]pentanedioic acid |
| SMILES | CC(C)(C)OC(=O)NC(CC(CCCOS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H26F3NO9S/c1-19(2,3)33-18(29)24-15(17(27)28)10-12(16(25)26)6-5-9-32-34(30,31)14-8-4-7-13(11-14)20(21,22)23/h4,7-8,11-12,15H,5-6,9-10H2,1-3H3,(H,24,29)(H,25,26)(H,27,28) |
| InChIKey | SPARCPWTFZKAAZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|