C8H12N2 — CID 123302768
(3E)-4-N-methylidenehepta-3,6-diene-2,4-diimine (PubChem CID 123302768) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (3E)-4-N-methylidenehepta-3,6-diene-2,4-diimine.
| Compound Name | (3E)-4-N-methylidenehepta-3,6-diene-2,4-diimine |
|---|---|
| PubChem CID | 123302768 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (3E)-4-N-methylidenehepta-3,6-diene-2,4-diimine |
| SMILES | [H]/N=C(C)/C=C(\CC=C)N=C |
| InChI | InChI=1S/C8H12N2/c1-4-5-8(10-3)6-7(2)9/h4,6,9H,1,3,5H2,2H3/b8-6+,9-7+ |
| InChIKey | NNZCZKROVHUTJJ-CDJQDVQCSA-N |
| XLogP | 2.19 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|