C10H16N2 — CID 163248548
(2Z,4E)-3,4-dimethylocta-2,4,7-trienimidamide (PubChem CID 163248548) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (2Z,4E)-3,4-dimethylocta-2,4,7-trienimidamide.
| Compound Name | (2Z,4E)-3,4-dimethylocta-2,4,7-trienimidamide |
|---|---|
| PubChem CID | 163248548 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (2Z,4E)-3,4-dimethylocta-2,4,7-trienimidamide |
| SMILES | [H]/N=C(N)/C=C(C)\C(C)=C\CC=C |
| InChI | InChI=1S/C10H16N2/c1-4-5-6-8(2)9(3)7-10(11)12/h4,6-7H,1,5H2,2-3H3,(H3,11,12)/b8-6+,9-7- |
| InChIKey | QWOZNMRPUJJRHI-FFELTBSMSA-N |
| XLogP | 2.39 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|