C11H18N4O — CID 90453122
(2R)-4-[(Z)-3-imino-1-(methylideneamino)but-1-enyl]-2-methylpiperazine-1-carbaldehyde (PubChem CID 90453122) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is (2R)-4-[(Z)-3-imino-1-(methylideneamino)but-1-enyl]-2-methylpiperazine-1-carbaldehyde.
| Compound Name | (2R)-4-[(Z)-3-imino-1-(methylideneamino)but-1-enyl]-2-methylpiperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 90453122 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (2R)-4-[(Z)-3-imino-1-(methylideneamino)but-1-enyl]-2-methylpiperazine-1-carbaldehyde |
| SMILES | [H]/N=C(C)/C=C(\N=C)N1CCN(C=O)[C@H](C)C1 |
| InChI | InChI=1S/C11H18N4O/c1-9(12)6-11(13-3)14-4-5-15(8-16)10(2)7-14/h6,8,10,12H,3-5,7H2,1-2H3/b11-6+,12-9+/t10-/m1/s1 |
| InChIKey | FDOHRDMXVTUPAK-QVZBLGBNSA-N |
| XLogP | 0.73 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|