C13H19N3 — CID 63603767
(3,4-dimethylpiperazin-1-yl)-phenylmethanimine (PubChem CID 63603767) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is (3,4-dimethylpiperazin-1-yl)-phenylmethanimine.
| Compound Name | (3,4-dimethylpiperazin-1-yl)-phenylmethanimine |
|---|---|
| PubChem CID | 63603767 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | (3,4-dimethylpiperazin-1-yl)-phenylmethanimine |
| SMILES | [H]/N=C(\c1ccccc1)N1CCN(C)C(C)C1 |
| InChI | InChI=1S/C13H19N3/c1-11-10-16(9-8-15(11)2)13(14)12-6-4-3-5-7-12/h3-7,11,14H,8-10H2,1-2H3/b14-13+ |
| InChIKey | UXELLOPUKSJHSZ-BUHFOSPRSA-N |
| XLogP | 1.65 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|