C21H27N3O — CID 23468688
[4-[2-(2,6-dimethylphenoxy)ethyl]piperazin-1-yl]-phenylmethanimine (PubChem CID 23468688) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is [4-[2-(2,6-dimethylphenoxy)ethyl]piperazin-1-yl]-phenylmethanimine.
| Compound Name | [4-[2-(2,6-dimethylphenoxy)ethyl]piperazin-1-yl]-phenylmethanimine |
|---|---|
| PubChem CID | 23468688 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | [4-[2-(2,6-dimethylphenoxy)ethyl]piperazin-1-yl]-phenylmethanimine |
| SMILES | [H]/N=C(\c1ccccc1)N1CCN(CCOc2c(C)cccc2C)CC1 |
| InChI | InChI=1S/C21H27N3O/c1-17-7-6-8-18(2)20(17)25-16-15-23-11-13-24(14-12-23)21(22)19-9-4-3-5-10-19/h3-10,22H,11-16H2,1-2H3/b22-21+ |
| InChIKey | YTPSUDQQWFVGJT-QURGRASLSA-N |
| XLogP | 3.33 |
| TPSA | 39.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|