C11H14N+ — CID 123304055
1-methyl-8,9-dihydro-5H-1-benzazepin-1-ium (PubChem CID 123304055) has the molecular formula C11H14N+ and a molecular weight of 160.24 g/mol. Its IUPAC name is 1-methyl-8,9-dihydro-5H-1-benzazepin-1-ium.
| Compound Name | 1-methyl-8,9-dihydro-5H-1-benzazepin-1-ium |
|---|---|
| PubChem CID | 123304055 |
| Molecular Formula | C11H14N+ |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 1-methyl-8,9-dihydro-5H-1-benzazepin-1-ium |
| SMILES | C[N+]1=CC=CCC2=C1CCC=C2 |
| InChI | InChI=1S/C11H14N/c1-12-9-5-4-7-10-6-2-3-8-11(10)12/h2,4-6,9H,3,7-8H2,1H3/q+1 |
| InChIKey | XEIHQOLHWJRLTL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|