About 4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol
4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol (PubChem CID 123304647) has the molecular formula C23H30O2
and a molecular weight of 338.49 g/mol. Its IUPAC name is 4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol.
Molecular Properties
| Compound Name | 4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol |
| PubChem CID | 123304647 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol |
| SMILES | CCC1CC(C)(CC)CC(c2ccc(O)cc2)(c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C23H30O2/c1-4-17-14-22(3,5-2)16-23(15-17,18-6-10-20(24)11-7-18)19-8-12-21(25)13-9-19/h6-13,17,24-25H,4-5,14-16H2,1-3H3 |
| InChIKey | OCCFVLMYAYUEBJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol?
The IUPAC name of 4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol (CID 123304647) is 4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol.
What is the SMILES notation for 4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol?
The canonical SMILES for 4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol is CCC1CC(C)(CC)CC(c2ccc(O)cc2)(c2ccc(O)cc2)C1.
What is the InChIKey of 4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol?
The InChIKey is OCCFVLMYAYUEBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30O2/c1-4-17-14-22(3,5-2)16-23(15-17,18-6-10-20(24)11-7-18)19-8-12-21(25)13-9-19/h6-13,17,24-25H,4-5,14-16H2,1-3H3.
What are the key properties of 4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol?
4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol has a molecular weight of 338.49 g/mol, XLogP of 6.01, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5-diethyl-1-(4-hydroxyphenyl)-3-methylcyclohexyl]phenol is sourced from PubChem (CID 123304647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).