About 3-imino-N'-propylpropanimidamide
3-imino-N'-propylpropanimidamide (PubChem CID 123307968) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is 3-imino-N'-propylpropanimidamide.
Molecular Properties
| Compound Name | 3-imino-N'-propylpropanimidamide |
| PubChem CID | 123307968 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 3-imino-N'-propylpropanimidamide |
| SMILES | [H]/N=C/C/C(N)=N/CCC |
| InChI | InChI=1S/C6H13N3/c1-2-5-9-6(8)3-4-7/h4,7H,2-3,5H2,1H3,(H2,8,9)/b7-4+ |
| InChIKey | RWQVOKXPONLWMO-QPJJXVBHSA-N |
| XLogP | 0.79 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-N'-propylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-N'-propylpropanimidamide?
The IUPAC name of 3-imino-N'-propylpropanimidamide (CID 123307968) is 3-imino-N'-propylpropanimidamide.
What is the SMILES notation for 3-imino-N'-propylpropanimidamide?
The canonical SMILES for 3-imino-N'-propylpropanimidamide is [H]/N=C/C/C(N)=N/CCC.
What is the InChIKey of 3-imino-N'-propylpropanimidamide?
The InChIKey is RWQVOKXPONLWMO-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H13N3/c1-2-5-9-6(8)3-4-7/h4,7H,2-3,5H2,1H3,(H2,8,9)/b7-4+.
What are the key properties of 3-imino-N'-propylpropanimidamide?
3-imino-N'-propylpropanimidamide has a molecular weight of 127.19 g/mol, XLogP of 0.79, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-N'-propylpropanimidamide is sourced from PubChem (CID 123307968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).