About 3-amino-N'-methylpropanimidamide
3-amino-N'-methylpropanimidamide (PubChem CID 15816396) has the molecular formula C4H11N3
and a molecular weight of 101.15 g/mol. Its IUPAC name is 3-amino-N'-methylpropanimidamide.
Molecular Properties
| Compound Name | 3-amino-N'-methylpropanimidamide |
| PubChem CID | 15816396 |
| Molecular Formula | C4H11N3 |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.10 |
| IUPAC Name | 3-amino-N'-methylpropanimidamide |
| SMILES | C/N=C(\N)CCN |
| InChI | InChI=1S/C4H11N3/c1-7-4(6)2-3-5/h2-3,5H2,1H3,(H2,6,7) |
| InChIKey | LSXVWCKSOVWVMH-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N'-methylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N'-methylpropanimidamide?
The IUPAC name of 3-amino-N'-methylpropanimidamide (CID 15816396) is 3-amino-N'-methylpropanimidamide.
What is the SMILES notation for 3-amino-N'-methylpropanimidamide?
The canonical SMILES for 3-amino-N'-methylpropanimidamide is C/N=C(\N)CCN.
What is the InChIKey of 3-amino-N'-methylpropanimidamide?
The InChIKey is LSXVWCKSOVWVMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3/c1-7-4(6)2-3-5/h2-3,5H2,1H3,(H2,6,7).
What are the key properties of 3-amino-N'-methylpropanimidamide?
3-amino-N'-methylpropanimidamide has a molecular weight of 101.15 g/mol, XLogP of -0.68, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N'-methylpropanimidamide is sourced from PubChem (CID 15816396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).