C7H16N4 — CID 12526538
1-N',3-N'-diethylpropanediimidamide (PubChem CID 12526538) has the molecular formula C7H16N4 and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-N',3-N'-diethylpropanediimidamide.
| Compound Name | 1-N',3-N'-diethylpropanediimidamide |
|---|---|
| PubChem CID | 12526538 |
| Molecular Formula | C7H16N4 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | 1-N',3-N'-diethylpropanediimidamide |
| SMILES | CC/N=C(\N)C/C(N)=N/CC |
| InChI | InChI=1S/C7H16N4/c1-3-10-6(8)5-7(9)11-4-2/h3-5H2,1-2H3,(H2,8,10)(H2,9,11) |
| InChIKey | LURLZBFFRGGLMT-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|