C17H25NO3 — CID 123309344
2,2,4-trimethyl-4-(4-propanoylphenoxy)pentanamide (PubChem CID 123309344) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-(4-propanoylphenoxy)pentanamide.
| Compound Name | 2,2,4-trimethyl-4-(4-propanoylphenoxy)pentanamide |
|---|---|
| PubChem CID | 123309344 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2,2,4-trimethyl-4-(4-propanoylphenoxy)pentanamide |
| SMILES | CCC(=O)c1ccc(OC(C)(C)CC(C)(C)C(N)=O)cc1 |
| InChI | InChI=1S/C17H25NO3/c1-6-14(19)12-7-9-13(10-8-12)21-17(4,5)11-16(2,3)15(18)20/h7-10H,6,11H2,1-5H3,(H2,18,20) |
| InChIKey | BGINFMRHPKYGTR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |