C17H23NO4 — CID 123626671
2,2,4-trimethyl-4-[3-(oxirane-2-carbonyl)phenoxy]pentanamide (PubChem CID 123626671) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-[3-(oxirane-2-carbonyl)phenoxy]pentanamide.
| Compound Name | 2,2,4-trimethyl-4-[3-(oxirane-2-carbonyl)phenoxy]pentanamide |
|---|---|
| PubChem CID | 123626671 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2,2,4-trimethyl-4-[3-(oxirane-2-carbonyl)phenoxy]pentanamide |
| SMILES | CC(C)(CC(C)(C)C(N)=O)Oc1cccc(C(=O)C2CO2)c1 |
| InChI | InChI=1S/C17H23NO4/c1-16(2,15(18)20)10-17(3,4)22-12-7-5-6-11(8-12)14(19)13-9-21-13/h5-8,13H,9-10H2,1-4H3,(H2,18,20) |
| InChIKey | CDNKANIYGROCAG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|