C17H21IO4 — CID 144941769
2,2,4-trimethyl-4-[3-(oxirane-2-carbonyl)phenoxy]pentanoyl iodide (PubChem CID 144941769) has the molecular formula C17H21IO4 and a molecular weight of 416.26 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-[3-(oxirane-2-carbonyl)phenoxy]pentanoyl iodide.
| Compound Name | 2,2,4-trimethyl-4-[3-(oxirane-2-carbonyl)phenoxy]pentanoyl iodide |
|---|---|
| PubChem CID | 144941769 |
| Molecular Formula | C17H21IO4 |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 2,2,4-trimethyl-4-[3-(oxirane-2-carbonyl)phenoxy]pentanoyl iodide |
| SMILES | CC(C)(CC(C)(C)C(=O)I)Oc1cccc(C(=O)C2CO2)c1 |
| InChI | InChI=1S/C17H21IO4/c1-16(2,15(18)20)10-17(3,4)22-12-7-5-6-11(8-12)14(19)13-9-21-13/h5-8,13H,9-10H2,1-4H3 |
| InChIKey | AETJYBZVFUPVBP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|