About 5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine
5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine (PubChem CID 123309462) has the molecular formula C13H17N3O2S
and a molecular weight of 279.36 g/mol. Its IUPAC name is 5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine.
Molecular Properties
| Compound Name | 5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine |
| PubChem CID | 123309462 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine |
| SMILES | CC1CCC(Oc2cccc3c2C(N)=NS(=O)N3)C1 |
| InChI | InChI=1S/C13H17N3O2S/c1-8-5-6-9(7-8)18-11-4-2-3-10-12(11)13(14)16-19(17)15-10/h2-4,8-9,15H,5-7H2,1H3,(H2,14,16) |
| InChIKey | JANVSTSGTVDQMO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine?
The IUPAC name of 5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine (CID 123309462) is 5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine.
What is the SMILES notation for 5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine?
The canonical SMILES for 5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine is CC1CCC(Oc2cccc3c2C(N)=NS(=O)N3)C1.
What is the InChIKey of 5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine?
The InChIKey is JANVSTSGTVDQMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2S/c1-8-5-6-9(7-8)18-11-4-2-3-10-12(11)13(14)16-19(17)15-10/h2-4,8-9,15H,5-7H2,1H3,(H2,14,16).
What are the key properties of 5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine?
5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine has a molecular weight of 279.36 g/mol, XLogP of 1.96, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methylcyclopentyl)oxy-2-oxo-1H-2λ4,1,3-benzothiadiazin-4-amine is sourced from PubChem (CID 123309462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).