C7H12N2O2 — CID 123310601
methyl 3,5-diimino-2-methylpentanoate (PubChem CID 123310601) has the molecular formula C7H12N2O2 and a molecular weight of 156.19 g/mol. Its IUPAC name is methyl 3,5-diimino-2-methylpentanoate.
| Compound Name | methyl 3,5-diimino-2-methylpentanoate |
|---|---|
| PubChem CID | 123310601 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | methyl 3,5-diimino-2-methylpentanoate |
| SMILES | [H]/N=C/C/C(=N\[H])C(C)C(=O)OC |
| InChI | InChI=1S/C7H12N2O2/c1-5(7(10)11-2)6(9)3-4-8/h4-5,8-9H,3H2,1-2H3/b8-4+,9-6+ |
| InChIKey | GONMDXDDIFTZJL-HNJDCKIISA-N |
| XLogP | 0.85 |
| TPSA | 74.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|