C19H22O3 — CID 123311299
methyl 2-[2-(2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)ethynyl]benzoate (PubChem CID 123311299) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is methyl 2-[2-(2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)ethynyl]benzoate.
| Compound Name | methyl 2-[2-(2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)ethynyl]benzoate |
|---|---|
| PubChem CID | 123311299 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | methyl 2-[2-(2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)ethynyl]benzoate |
| SMILES | COC(=O)c1ccccc1C#CC1(O)C2CCC(C2)C1(C)C |
| InChI | InChI=1S/C19H22O3/c1-18(2)14-8-9-15(12-14)19(18,21)11-10-13-6-4-5-7-16(13)17(20)22-3/h4-7,14-15,21H,8-9,12H2,1-3H3 |
| InChIKey | XUJFVJKKDVVQKH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|