C6H9F2NO — CID 123311526
7,7-difluoro-2-oxa-5-azabicyclo[4.2.0]octane (PubChem CID 123311526) has the molecular formula C6H9F2NO and a molecular weight of 149.14 g/mol. Its IUPAC name is 7,7-difluoro-2-oxa-5-azabicyclo[4.2.0]octane.
| Compound Name | 7,7-difluoro-2-oxa-5-azabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 123311526 |
| Molecular Formula | C6H9F2NO |
| Molecular Weight | 149.14 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 7,7-difluoro-2-oxa-5-azabicyclo[4.2.0]octane |
| SMILES | FC1(F)CC2OCCNC21 |
| InChI | InChI=1S/C6H9F2NO/c7-6(8)3-4-5(6)9-1-2-10-4/h4-5,9H,1-3H2 |
| InChIKey | PNJIKMXCYWRQAZ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.14 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |